C24H24Cl2N4O4 — CID 67994490
ethyl 3-[5-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-6-oxo-1,3,5-triazin-2-yl]prop-2-enoate (PubChem CID 67994490) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is ethyl 3-[5-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-6-oxo-1,3,5-triazin-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[5-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-6-oxo-1,3,5-triazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67994490 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | ethyl 3-[5-[(4-chlorophenyl)methyl]-4-(3-chloro-4-propan-2-yloxyanilino)-6-oxo-1,3,5-triazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1nc(Nc2ccc(OC(C)C)c(Cl)c2)n(Cc2ccc(Cl)cc2)c(=O)n1 |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-4-33-22(31)12-11-21-28-23(27-18-9-10-20(19(26)13-18)34-15(2)3)30(24(32)29-21)14-16-5-7-17(25)8-6-16/h5-13,15H,4,14H2,1-3H3,(H,27,28,29,32) |
| InChIKey | CJJFXTLKNUXXEP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|