C16H16N8O2 — CID 67995775
2-N-(1H-indazol-5-yl)-6-N-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitropyridine-2,6-diamine (PubChem CID 67995775) has the molecular formula C16H16N8O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-N-(1H-indazol-5-yl)-6-N-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(1H-indazol-5-yl)-6-N-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 67995775 |
| Molecular Formula | C16H16N8O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-N-(1H-indazol-5-yl)-6-N-(2-methyl-4,5-dihydroimidazol-1-yl)-3-nitropyridine-2,6-diamine |
| SMILES | CC1=NCCN1Nc1ccc([N+](=O)[O-])c(Nc2ccc3[nH]ncc3c2)n1 |
| InChI | InChI=1S/C16H16N8O2/c1-10-17-6-7-23(10)22-15-5-4-14(24(25)26)16(20-15)19-12-2-3-13-11(8-12)9-18-21-13/h2-5,8-9H,6-7H2,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | XPXAOUODGDEGJA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|