C20H25N7O2 — CID 67995863
N-[3-nitro-6-(3,3,5,5-tetramethylpiperazin-1-yl)-2-pyridinyl]-1H-indazol-5-amine (PubChem CID 67995863) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-[3-nitro-6-(3,3,5,5-tetramethylpiperazin-1-yl)-2-pyridinyl]-1H-indazol-5-amine.
| Compound Name | N-[3-nitro-6-(3,3,5,5-tetramethylpiperazin-1-yl)-2-pyridinyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 67995863 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[3-nitro-6-(3,3,5,5-tetramethylpiperazin-1-yl)-2-pyridinyl]-1H-indazol-5-amine |
| SMILES | CC1(C)CN(c2ccc([N+](=O)[O-])c(Nc3ccc4[nH]ncc4c3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C20H25N7O2/c1-19(2)11-26(12-20(3,4)25-19)17-8-7-16(27(28)29)18(23-17)22-14-5-6-15-13(9-14)10-21-24-15/h5-10,25H,11-12H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | SONDXJHOXFREPA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|