C17H21N7O3S — CID 67996249
4-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide (PubChem CID 67996249) has the molecular formula C17H21N7O3S and a molecular weight of 403.47 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide.
| Compound Name | 4-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 67996249 |
| Molecular Formula | C17H21N7O3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N2CCCC2CO)c(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C17H21N7O3S/c1-18-28(26,27)12-4-5-14(24-6-2-3-11(24)8-25)13(7-12)23-17-15-16(20-9-19-15)21-10-22-17/h4-5,7,9-11,18,25H,2-3,6,8H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | CWXOFKFHBDZRPD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 136.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |