C19H26N8OS — CID 123860975
4-[4-(dimethylamino)piperidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide (PubChem CID 123860975) has the molecular formula C19H26N8OS and a molecular weight of 414.54 g/mol. Its IUPAC name is 4-[4-(dimethylamino)piperidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide.
| Compound Name | 4-[4-(dimethylamino)piperidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide |
|---|---|
| PubChem CID | 123860975 |
| Molecular Formula | C19H26N8OS |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 4-[4-(dimethylamino)piperidin-1-yl]-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide |
| SMILES | CNS(=O)c1ccc(N2CCC(N(C)C)CC2)c(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C19H26N8OS/c1-20-29(28)14-4-5-16(27-8-6-13(7-9-27)26(2)3)15(10-14)25-19-17-18(22-11-21-17)23-12-24-19/h4-5,10-13,20H,6-9H2,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | FXBMSUCTAZVJCK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |