C13H11N7O2 — CID 146257759
2-methyl-6-(7H-purin-6-ylamino)-3H-imidazo[1,5-a]pyridine-1,5-dione (PubChem CID 146257759) has the molecular formula C13H11N7O2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-methyl-6-(7H-purin-6-ylamino)-3H-imidazo[1,5-a]pyridine-1,5-dione.
| Compound Name | 2-methyl-6-(7H-purin-6-ylamino)-3H-imidazo[1,5-a]pyridine-1,5-dione |
|---|---|
| PubChem CID | 146257759 |
| Molecular Formula | C13H11N7O2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-methyl-6-(7H-purin-6-ylamino)-3H-imidazo[1,5-a]pyridine-1,5-dione |
| SMILES | CN1Cn2c(ccc(Nc3ncnc4nc[nH]c34)c2=O)C1=O |
| InChI | InChI=1S/C13H11N7O2/c1-19-6-20-8(13(19)22)3-2-7(12(20)21)18-11-9-10(15-4-14-9)16-5-17-11/h2-5H,6H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | VFZFNOBGRZSNMT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |