C19H24N6O2S — CID 123796680
4-cycloheptyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide (PubChem CID 123796680) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is 4-cycloheptyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide.
| Compound Name | 4-cycloheptyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide |
|---|---|
| PubChem CID | 123796680 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-cycloheptyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfinamide |
| SMILES | CNS(=O)c1ccc(OC2CCCCCC2)c(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C19H24N6O2S/c1-20-28(26)14-8-9-16(27-13-6-4-2-3-5-7-13)15(10-14)25-19-17-18(22-11-21-17)23-12-24-19/h8-13,20H,2-7H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | XLJUOPXPXGSVJR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |