C19H25N6O2S+ — CID 123431655
4-[[6-(cyclohexylmethoxy)-7H-purin-1-ium-2-yl]amino]-N-methylbenzenesulfinamide (PubChem CID 123431655) has the molecular formula C19H25N6O2S+ and a molecular weight of 401.52 g/mol. Its IUPAC name is 4-[[6-(cyclohexylmethoxy)-7H-purin-1-ium-2-yl]amino]-N-methylbenzenesulfinamide.
| Compound Name | 4-[[6-(cyclohexylmethoxy)-7H-purin-1-ium-2-yl]amino]-N-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 123431655 |
| Molecular Formula | C19H25N6O2S+ |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[[6-(cyclohexylmethoxy)-7H-purin-1-ium-2-yl]amino]-N-methylbenzenesulfinamide |
| SMILES | CNS(=O)c1ccc(Nc2nc3nc[nH]c3c(OCC3CCCCC3)[nH+]2)cc1 |
| InChI | InChI=1S/C19H24N6O2S/c1-20-28(26)15-9-7-14(8-10-15)23-19-24-17-16(21-12-22-17)18(25-19)27-11-13-5-3-2-4-6-13/h7-10,12-13,20H,2-6,11H2,1H3,(H2,21,22,23,24,25)/p+1 |
| InChIKey | IGRXRZUNMVMACP-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |