C18H20FN5O — CID 5329558
6-(cyclohexylmethoxy)-N-(4-fluorophenyl)-7H-purin-2-amine (PubChem CID 5329558) has the molecular formula C18H20FN5O and a molecular weight of 341.39 g/mol. Its IUPAC name is 6-(cyclohexylmethoxy)-N-(4-fluorophenyl)-7H-purin-2-amine.
| Compound Name | 6-(cyclohexylmethoxy)-N-(4-fluorophenyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 5329558 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 6-(cyclohexylmethoxy)-N-(4-fluorophenyl)-7H-purin-2-amine |
| SMILES | Fc1ccc(Nc2nc(OCC3CCCCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C18H20FN5O/c19-13-6-8-14(9-7-13)22-18-23-16-15(20-11-21-16)17(24-18)25-10-12-4-2-1-3-5-12/h6-9,11-12H,1-5,10H2,(H2,20,21,22,23,24) |
| InChIKey | UEWGJZTVOIUVGM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |