C18H22N6OS — CID 143651391
S-[4-[[4-(cyclohexylmethoxy)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]amino]phenyl]thiohydroxylamine (PubChem CID 143651391) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is S-[4-[[4-(cyclohexylmethoxy)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[[4-(cyclohexylmethoxy)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143651391 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | S-[4-[[4-(cyclohexylmethoxy)-1H-pyrazolo[5,4-d]pyrimidin-6-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(Nc2nc(OCC3CCCCC3)c3cn[nH]c3n2)cc1 |
| InChI | InChI=1S/C18H22N6OS/c19-26-14-8-6-13(7-9-14)21-18-22-16-15(10-20-24-16)17(23-18)25-11-12-4-2-1-3-5-12/h6-10,12H,1-5,11,19H2,(H2,20,21,22,23,24) |
| InChIKey | GLGGJVQUHWYXSR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|