C20H22ClN5O3S — CID 73297270
N-[4-(1-chloroethenylsulfonyl)phenyl]-6-(cyclohexylmethoxy)-7H-purin-2-amine (PubChem CID 73297270) has the molecular formula C20H22ClN5O3S and a molecular weight of 447.95 g/mol. Its IUPAC name is N-[4-(1-chloroethenylsulfonyl)phenyl]-6-(cyclohexylmethoxy)-7H-purin-2-amine.
| Compound Name | N-[4-(1-chloroethenylsulfonyl)phenyl]-6-(cyclohexylmethoxy)-7H-purin-2-amine |
|---|---|
| PubChem CID | 73297270 |
| Molecular Formula | C20H22ClN5O3S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[4-(1-chloroethenylsulfonyl)phenyl]-6-(cyclohexylmethoxy)-7H-purin-2-amine |
| SMILES | C=C(Cl)S(=O)(=O)c1ccc(Nc2nc(OCC3CCCCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C20H22ClN5O3S/c1-13(21)30(27,28)16-9-7-15(8-10-16)24-20-25-18-17(22-12-23-18)19(26-20)29-11-14-5-3-2-4-6-14/h7-10,12,14H,1-6,11H2,(H2,22,23,24,25,26) |
| InChIKey | VGBZEBNJKNLXQW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |