C19H24N5O3S+ — CID 123841356
6-(cyclohexylmethoxy)-N-(4-methylsulfonylphenyl)-7H-purin-1-ium-2-amine (PubChem CID 123841356) has the molecular formula C19H24N5O3S+ and a molecular weight of 402.50 g/mol. Its IUPAC name is 6-(cyclohexylmethoxy)-N-(4-methylsulfonylphenyl)-7H-purin-1-ium-2-amine.
| Compound Name | 6-(cyclohexylmethoxy)-N-(4-methylsulfonylphenyl)-7H-purin-1-ium-2-amine |
|---|---|
| PubChem CID | 123841356 |
| Molecular Formula | C19H24N5O3S+ |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-(cyclohexylmethoxy)-N-(4-methylsulfonylphenyl)-7H-purin-1-ium-2-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2nc3nc[nH]c3c(OCC3CCCCC3)[nH+]2)cc1 |
| InChI | InChI=1S/C19H23N5O3S/c1-28(25,26)15-9-7-14(8-10-15)22-19-23-17-16(20-12-21-17)18(24-19)27-11-13-5-3-2-4-6-13/h7-10,12-13H,2-6,11H2,1H3,(H2,20,21,22,23,24)/p+1 |
| InChIKey | HDNMVIDGHCLPLB-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |