C18H21N5O — CID 166340246
N-[4-(cyclohexylmethoxy)phenyl]-7H-purin-6-amine (PubChem CID 166340246) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[4-(cyclohexylmethoxy)phenyl]-7H-purin-6-amine.
| Compound Name | N-[4-(cyclohexylmethoxy)phenyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 166340246 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[4-(cyclohexylmethoxy)phenyl]-7H-purin-6-amine |
| SMILES | c1nc(Nc2ccc(OCC3CCCCC3)cc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C18H21N5O/c1-2-4-13(5-3-1)10-24-15-8-6-14(7-9-15)23-18-16-17(20-11-19-16)21-12-22-18/h6-9,11-13H,1-5,10H2,(H2,19,20,21,22,23) |
| InChIKey | NTZAHPPKLVAJEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |