C24H32N6O4 — CID 67999243
tert-butyl 3-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]morpholine-4-carboxylate (PubChem CID 67999243) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is tert-butyl 3-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 67999243 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | tert-butyl 3-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]morpholine-4-carboxylate |
| SMILES | C[C@@H]1CCN(C(=O)C2COCCN2C(=O)OC(C)(C)C)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C24H32N6O4/c1-15-6-8-28(22(31)19-14-33-10-9-29(19)23(32)34-24(2,3)4)13-17(15)21-27-12-16-11-26-20-18(30(16)21)5-7-25-20/h5,7,11-12,15,17,19,25H,6,8-10,13-14H2,1-4H3/t15-,17+,19?/m1/s1 |
| InChIKey | JHGQQGBODPYOBP-GIAWROPOSA-N |
| XLogP | 2.80 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |