C19H25N3O5 — CID 6806620
2,4,16-tris(hydroxyimino)-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 6806620) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2,4,16-tris(hydroxyimino)-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 2,4,16-tris(hydroxyimino)-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 6806620 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2,4,16-tris(hydroxyimino)-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC12CCC3C(CCC4C(=NO)C(=O)C(=NO)CC43C)C1CC(=NO)C2=O |
| InChI | InChI=1S/C19H25N3O5/c1-18-6-5-10-9(12(18)7-13(20-25)17(18)24)3-4-11-15(22-27)16(23)14(21-26)8-19(10,11)2/h9-12,25-27H,3-8H2,1-2H3 |
| InChIKey | NXCBMMQBNAUFSJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|