C17H18N4O4 — CID 6837215
(6Z)-6-[(4-nitrophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid (PubChem CID 6837215) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is (6Z)-6-[(4-nitrophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid.
| Compound Name | (6Z)-6-[(4-nitrophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid |
|---|---|
| PubChem CID | 6837215 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (6Z)-6-[(4-nitrophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid |
| SMILES | O=C(O)CCCC/C(=N/Nc1ccc([N+](=O)[O-])cc1)c1ccccn1 |
| InChI | InChI=1S/C17H18N4O4/c22-17(23)7-2-1-6-16(15-5-3-4-12-18-15)20-19-13-8-10-14(11-9-13)21(24)25/h3-5,8-12,19H,1-2,6-7H2,(H,22,23)/b20-16- |
| InChIKey | KLOPOQSOKOWVIF-SILNSSARSA-N |
| XLogP | 3.45 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|