C17H18FN3O2 — CID 7596836
(6E)-6-[(2-fluorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid (PubChem CID 7596836) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is (6E)-6-[(2-fluorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid.
| Compound Name | (6E)-6-[(2-fluorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid |
|---|---|
| PubChem CID | 7596836 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (6E)-6-[(2-fluorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid |
| SMILES | O=C(O)CCCC/C(=N\Nc1ccccc1F)c1ccccn1 |
| InChI | InChI=1S/C17H18FN3O2/c18-13-7-1-2-8-14(13)20-21-16(10-3-4-11-17(22)23)15-9-5-6-12-19-15/h1-2,5-9,12,20H,3-4,10-11H2,(H,22,23)/b21-16+ |
| InChIKey | YGKOPZGJYWFPRC-LTGZKZEYSA-N |
| XLogP | 3.68 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|