C18H20N3O2- — CID 6198728
(6Z)-6-[(4-methylphenyl)hydrazinylidene]-6-pyridin-2-ylhexanoate (PubChem CID 6198728) has the molecular formula C18H20N3O2- and a molecular weight of 310.38 g/mol. Its IUPAC name is (6Z)-6-[(4-methylphenyl)hydrazinylidene]-6-pyridin-2-ylhexanoate.
| Compound Name | (6Z)-6-[(4-methylphenyl)hydrazinylidene]-6-pyridin-2-ylhexanoate |
|---|---|
| PubChem CID | 6198728 |
| Molecular Formula | C18H20N3O2- |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (6Z)-6-[(4-methylphenyl)hydrazinylidene]-6-pyridin-2-ylhexanoate |
| SMILES | Cc1ccc(N/N=C(/CCCCC(=O)[O-])c2ccccn2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-14-9-11-15(12-10-14)20-21-17(7-2-3-8-18(22)23)16-6-4-5-13-19-16/h4-6,9-13,20H,2-3,7-8H2,1H3,(H,22,23)/p-1/b21-17- |
| InChIKey | BMVJPCHIZHZLEM-FXBPSFAMSA-M |
| XLogP | 2.52 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|