C17H17Cl2N3O2 — CID 4728718
6-[(2,5-dichlorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid (PubChem CID 4728718) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 6-[(2,5-dichlorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid.
| Compound Name | 6-[(2,5-dichlorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid |
|---|---|
| PubChem CID | 4728718 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 6-[(2,5-dichlorophenyl)hydrazinylidene]-6-pyridin-2-ylhexanoic acid |
| SMILES | O=C(O)CCCCC(=NNc1cc(Cl)ccc1Cl)c1ccccn1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-12-8-9-13(19)16(11-12)22-21-15(6-1-2-7-17(23)24)14-5-3-4-10-20-14/h3-5,8-11,22H,1-2,6-7H2,(H,23,24) |
| InChIKey | OCFCOIVVHSSHIK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|