C25H21ClN4O2 — CID 6845161
N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-6-chloropyridazin-3-amine (PubChem CID 6845161) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-6-chloropyridazin-3-amine.
| Compound Name | N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-6-chloropyridazin-3-amine |
|---|---|
| PubChem CID | 6845161 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-6-chloropyridazin-3-amine |
| SMILES | Clc1ccc(NN=Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)nn1 |
| InChI | InChI=1S/C25H21ClN4O2/c26-24-13-14-25(30-28-24)29-27-16-21-11-12-22(31-17-19-7-3-1-4-8-19)23(15-21)32-18-20-9-5-2-6-10-20/h1-16H,17-18H2,(H,29,30) |
| InChIKey | CBTPHXAORJIKFJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|