C12H13F3O2 — CID 684565
(5R)-6,6,6-trifluoro-5-hydroxy-5-phenylhexan-3-one (PubChem CID 684565) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is (5R)-6,6,6-trifluoro-5-hydroxy-5-phenylhexan-3-one.
| Compound Name | (5R)-6,6,6-trifluoro-5-hydroxy-5-phenylhexan-3-one |
|---|---|
| PubChem CID | 684565 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (5R)-6,6,6-trifluoro-5-hydroxy-5-phenylhexan-3-one |
| SMILES | CCC(=O)C[C@@](O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O2/c1-2-10(16)8-11(17,12(13,14)15)9-6-4-3-5-7-9/h3-7,17H,2,8H2,1H3/t11-/m1/s1 |
| InChIKey | QCVZPLFWQXHAKD-LLVKDONJSA-N |
| XLogP | 2.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |