C22H28ClN3O3 — CID 68502387
[2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 68502387) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is [2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 68502387 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1coc(-c2ccc(OCCCCl)cc2)n1)N1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C22H28ClN3O3/c23-10-4-14-28-19-8-6-17(7-9-19)21-24-20(16-29-21)22(27)26-13-3-5-18(26)15-25-11-1-2-12-25/h6-9,16,18H,1-5,10-15H2/t18-/m0/s1 |
| InChIKey | XWSQYFJDRUTWDS-SFHVURJKSA-N |
| XLogP | 4.05 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|