C19H25BrF3N3O8 — CID 68502573
[(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(ethenoxymethyl)oxolan-3-yl] 6-aminohexanoate;2,2,2-trifluoroacetic acid (PubChem CID 68502573) has the molecular formula C19H25BrF3N3O8 and a molecular weight of 560.32 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(ethenoxymethyl)oxolan-3-yl] 6-aminohexanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(ethenoxymethyl)oxolan-3-yl] 6-aminohexanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68502573 |
| Molecular Formula | C19H25BrF3N3O8 |
| Molecular Weight | 560.32 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | [(2R,3S,5R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-2-(ethenoxymethyl)oxolan-3-yl] 6-aminohexanoate;2,2,2-trifluoroacetic acid |
| SMILES | C=COC[C@H]1O[C@@H](n2cc(Br)c(=O)[nH]c2=O)C[C@@H]1OC(=O)CCCCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24BrN3O6.C2HF3O2/c1-2-25-10-13-12(27-15(22)6-4-3-5-7-19)8-14(26-13)21-9-11(18)16(23)20-17(21)24;3-2(4,5)1(6)7/h2,9,12-14H,1,3-8,10,19H2,(H,20,23,24);(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | TYCVZVYJIFCTQT-SOIKFHLCSA-N |
| XLogP | 1.81 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|