C30H32O6 — CID 68509388
[1,4-dihydroxy-4-(4-pent-4-enoxybenzoyl)cyclohexa-2,5-dien-1-yl]-(4-pent-4-enoxyphenyl)methanone (PubChem CID 68509388) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is [1,4-dihydroxy-4-(4-pent-4-enoxybenzoyl)cyclohexa-2,5-dien-1-yl]-(4-pent-4-enoxyphenyl)methanone.
| Compound Name | [1,4-dihydroxy-4-(4-pent-4-enoxybenzoyl)cyclohexa-2,5-dien-1-yl]-(4-pent-4-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 68509388 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [1,4-dihydroxy-4-(4-pent-4-enoxybenzoyl)cyclohexa-2,5-dien-1-yl]-(4-pent-4-enoxyphenyl)methanone |
| SMILES | C=CCCCOc1ccc(C(=O)C2(O)C=CC(O)(C(=O)c3ccc(OCCCC=C)cc3)C=C2)cc1 |
| InChI | InChI=1S/C30H32O6/c1-3-5-7-21-35-25-13-9-23(10-14-25)27(31)29(33)17-19-30(34,20-18-29)28(32)24-11-15-26(16-12-24)36-22-8-6-4-2/h3-4,9-20,33-34H,1-2,5-8,21-22H2 |
| InChIKey | SIHMJDHZARYPPV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|