C17H23ClFN3O — CID 68509637
8-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1-methylquinolin-2-one;hydrochloride (PubChem CID 68509637) has the molecular formula C17H23ClFN3O and a molecular weight of 339.84 g/mol. Its IUPAC name is 8-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1-methylquinolin-2-one;hydrochloride.
| Compound Name | 8-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1-methylquinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68509637 |
| Molecular Formula | C17H23ClFN3O |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 8-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1-methylquinolin-2-one;hydrochloride |
| SMILES | Cl.Cn1c(=O)ccc2ccc(F)c(CCN3CCC(N)CC3)c21 |
| InChI | InChI=1S/C17H22FN3O.ClH/c1-20-16(22)5-3-12-2-4-15(18)14(17(12)20)8-11-21-9-6-13(19)7-10-21;/h2-5,13H,6-11,19H2,1H3;1H |
| InChIKey | ISPWMHQQSGCMBQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |