C15H18F2N4O — CID 66775179
1-[2-(4-aminopiperidin-1-yl)ethyl]-7,8-difluoroquinoxalin-2-one (PubChem CID 66775179) has the molecular formula C15H18F2N4O and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[2-(4-aminopiperidin-1-yl)ethyl]-7,8-difluoroquinoxalin-2-one.
| Compound Name | 1-[2-(4-aminopiperidin-1-yl)ethyl]-7,8-difluoroquinoxalin-2-one |
|---|---|
| PubChem CID | 66775179 |
| Molecular Formula | C15H18F2N4O |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[2-(4-aminopiperidin-1-yl)ethyl]-7,8-difluoroquinoxalin-2-one |
| SMILES | NC1CCN(CCn2c(=O)cnc3ccc(F)c(F)c32)CC1 |
| InChI | InChI=1S/C15H18F2N4O/c16-11-1-2-12-15(14(11)17)21(13(22)9-19-12)8-7-20-5-3-10(18)4-6-20/h1-2,9-10H,3-8,18H2 |
| InChIKey | FUFFBVLKYSPQMD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |