C15H19FN4O2 — CID 68820161
1-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-5-oxido-1,5-naphthyridin-5-ium-2-one (PubChem CID 68820161) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-5-oxido-1,5-naphthyridin-5-ium-2-one.
| Compound Name | 1-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-5-oxido-1,5-naphthyridin-5-ium-2-one |
|---|---|
| PubChem CID | 68820161 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-[2-(4-aminopiperidin-1-yl)ethyl]-7-fluoro-5-oxido-1,5-naphthyridin-5-ium-2-one |
| SMILES | NC1CCN(CCn2c(=O)ccc3c2cc(F)c[n+]3[O-])CC1 |
| InChI | InChI=1S/C15H19FN4O2/c16-11-9-14-13(20(22)10-11)1-2-15(21)19(14)8-7-18-5-3-12(17)4-6-18/h1-2,9-10,12H,3-8,17H2 |
| InChIKey | MNWDWXOGDUBNPZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|