C32H31NO5 — CID 68509806
2-[(4-methoxyphenyl)methoxy]-1-nitro-3-[(Z)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]benzene (PubChem CID 68509806) has the molecular formula C32H31NO5 and a molecular weight of 509.60 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]-1-nitro-3-[(Z)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]benzene.
| Compound Name | 2-[(4-methoxyphenyl)methoxy]-1-nitro-3-[(Z)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 68509806 |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]-1-nitro-3-[(Z)-2-[4-(4-phenylbutoxy)phenyl]ethenyl]benzene |
| SMILES | COc1ccc(COc2c(/C=C\c3ccc(OCCCCc4ccccc4)cc3)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H31NO5/c1-36-29-19-16-27(17-20-29)24-38-32-28(11-7-12-31(32)33(34)35)18-13-26-14-21-30(22-15-26)37-23-6-5-10-25-8-3-2-4-9-25/h2-4,7-9,11-22H,5-6,10,23-24H2,1H3/b18-13- |
| InChIKey | DOORKYXHKBLZTM-AQTBWJFISA-N |
| XLogP | 7.75 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|