C28H23FO6 — CID 70149727
[8-[(E)-2-[4-[4-(4-fluorophenyl)butoxy]phenyl]ethenyl]-4-oxochromen-2-yl] hydrogen carbonate (PubChem CID 70149727) has the molecular formula C28H23FO6 and a molecular weight of 474.48 g/mol. Its IUPAC name is [8-[(E)-2-[4-[4-(4-fluorophenyl)butoxy]phenyl]ethenyl]-4-oxochromen-2-yl] hydrogen carbonate.
| Compound Name | [8-[(E)-2-[4-[4-(4-fluorophenyl)butoxy]phenyl]ethenyl]-4-oxochromen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70149727 |
| Molecular Formula | C28H23FO6 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [8-[(E)-2-[4-[4-(4-fluorophenyl)butoxy]phenyl]ethenyl]-4-oxochromen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(=O)c2cccc(/C=C/c3ccc(OCCCCc4ccc(F)cc4)cc3)c2o1 |
| InChI | InChI=1S/C28H23FO6/c29-22-13-8-19(9-14-22)4-1-2-17-33-23-15-10-20(11-16-23)7-12-21-5-3-6-24-25(30)18-26(34-27(21)24)35-28(31)32/h3,5-16,18H,1-2,4,17H2,(H,31,32)/b12-7+ |
| InChIKey | NEAJIRZBSAVQAD-KPKJPENVSA-N |
| XLogP | 6.56 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|