C16H10N4O2 — CID 685105
4-amino-2-pyridin-3-ylchromeno[4,3-d]pyrimidin-5-one (PubChem CID 685105) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-amino-2-pyridin-3-ylchromeno[4,3-d]pyrimidin-5-one.
| Compound Name | 4-amino-2-pyridin-3-ylchromeno[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 685105 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-amino-2-pyridin-3-ylchromeno[4,3-d]pyrimidin-5-one |
| SMILES | Nc1nc(-c2cccnc2)nc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C16H10N4O2/c17-14-12-13(10-5-1-2-6-11(10)22-16(12)21)19-15(20-14)9-4-3-7-18-8-9/h1-8H,(H2,17,19,20) |
| InChIKey | JZYCISJUXYOTRO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|