C23H14FN3O5S — CID 171347595
[3-(4-amino-5-oxochromeno[4,3-d]pyrimidin-2-yl)phenyl] 4-fluorobenzenesulfonate (PubChem CID 171347595) has the molecular formula C23H14FN3O5S and a molecular weight of 463.45 g/mol. Its IUPAC name is [3-(4-amino-5-oxochromeno[4,3-d]pyrimidin-2-yl)phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-(4-amino-5-oxochromeno[4,3-d]pyrimidin-2-yl)phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 171347595 |
| Molecular Formula | C23H14FN3O5S |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | [3-(4-amino-5-oxochromeno[4,3-d]pyrimidin-2-yl)phenyl] 4-fluorobenzenesulfonate |
| SMILES | Nc1nc(-c2cccc(OS(=O)(=O)c3ccc(F)cc3)c2)nc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C23H14FN3O5S/c24-14-8-10-16(11-9-14)33(29,30)32-15-5-3-4-13(12-15)22-26-20-17-6-1-2-7-18(17)31-23(28)19(20)21(25)27-22/h1-12H,(H2,25,26,27) |
| InChIKey | PKPBBWLGAUDWLX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|