C15H9N3O2S — CID 21230603
4-amino-2-thiophen-2-ylchromeno[4,3-d]pyrimidin-5-one (PubChem CID 21230603) has the molecular formula C15H9N3O2S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-amino-2-thiophen-2-ylchromeno[4,3-d]pyrimidin-5-one.
| Compound Name | 4-amino-2-thiophen-2-ylchromeno[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 21230603 |
| Molecular Formula | C15H9N3O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 4-amino-2-thiophen-2-ylchromeno[4,3-d]pyrimidin-5-one |
| SMILES | Nc1nc(-c2cccs2)nc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C15H9N3O2S/c16-13-11-12(17-14(18-13)10-6-3-7-21-10)8-4-1-2-5-9(8)20-15(11)19/h1-7H,(H2,16,17,18) |
| InChIKey | AFKDSNLDNGZNEP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|