C16H20ClN3O2S — CID 68511984
ethyl N-[2-amino-4-[(5-chlorothiophen-2-yl)methyl-ethylamino]phenyl]carbamate (PubChem CID 68511984) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is ethyl N-[2-amino-4-[(5-chlorothiophen-2-yl)methyl-ethylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-4-[(5-chlorothiophen-2-yl)methyl-ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 68511984 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | ethyl N-[2-amino-4-[(5-chlorothiophen-2-yl)methyl-ethylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(N(CC)Cc2ccc(Cl)s2)cc1N |
| InChI | InChI=1S/C16H20ClN3O2S/c1-3-20(10-12-6-8-15(17)23-12)11-5-7-14(13(18)9-11)19-16(21)22-4-2/h5-9H,3-4,10,18H2,1-2H3,(H,19,21) |
| InChIKey | IJHUAAPUXUHKRF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|