C23H21F4N3O2 — CID 69266372
ethyl N-[2-amino-4-[(4-fluoro-N-[3-(trifluoromethyl)phenyl]anilino)methyl]phenyl]carbamate (PubChem CID 69266372) has the molecular formula C23H21F4N3O2 and a molecular weight of 447.43 g/mol. Its IUPAC name is ethyl N-[2-amino-4-[(4-fluoro-N-[3-(trifluoromethyl)phenyl]anilino)methyl]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-4-[(4-fluoro-N-[3-(trifluoromethyl)phenyl]anilino)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69266372 |
| Molecular Formula | C23H21F4N3O2 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | ethyl N-[2-amino-4-[(4-fluoro-N-[3-(trifluoromethyl)phenyl]anilino)methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(CN(c2ccc(F)cc2)c2cccc(C(F)(F)F)c2)cc1N |
| InChI | InChI=1S/C23H21F4N3O2/c1-2-32-22(31)29-21-11-6-15(12-20(21)28)14-30(18-9-7-17(24)8-10-18)19-5-3-4-16(13-19)23(25,26)27/h3-13H,2,14,28H2,1H3,(H,29,31) |
| InChIKey | HTQPZNSQOPJYFX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|