C10H7N3 — CID 68522367
4,8,11-triazatricyclo[7.4.0.02,7]trideca-1,3,5,7,9,11-hexaene (PubChem CID 68522367) has the molecular formula C10H7N3 and a molecular weight of 169.19 g/mol. Its IUPAC name is 4,8,11-triazatricyclo[7.4.0.02,7]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 4,8,11-triazatricyclo[7.4.0.02,7]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 68522367 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 4,8,11-triazatricyclo[7.4.0.02,7]trideca-1,3,5,7,9,11-hexaene |
| SMILES | C1=NC=C2N=c3ccncc3=C2C1 |
| InChI | InChI=1S/C10H7N3/c1-3-12-6-10-7(1)8-5-11-4-2-9(8)13-10/h2-6H,1H2 |
| InChIKey | CQJBFZFNLGUEBD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |