C11H14FNO3 — CID 68527520
2-(3-fluoro-4-hydroxy-N-methylanilino)butanoic acid (PubChem CID 68527520) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxy-N-methylanilino)butanoic acid.
| Compound Name | 2-(3-fluoro-4-hydroxy-N-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 68527520 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(3-fluoro-4-hydroxy-N-methylanilino)butanoic acid |
| SMILES | CCC(C(=O)O)N(C)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C11H14FNO3/c1-3-9(11(15)16)13(2)7-4-5-10(14)8(12)6-7/h4-6,9,14H,3H2,1-2H3,(H,15,16) |
| InChIKey | OOYYPAIRSXYSBC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |