C10H14ClFN2O2 — CID 67361117
2-(N-amino-4-fluoroanilino)butanoic acid;hydrochloride (PubChem CID 67361117) has the molecular formula C10H14ClFN2O2 and a molecular weight of 248.69 g/mol. Its IUPAC name is 2-(N-amino-4-fluoroanilino)butanoic acid;hydrochloride.
| Compound Name | 2-(N-amino-4-fluoroanilino)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67361117 |
| Molecular Formula | C10H14ClFN2O2 |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-(N-amino-4-fluoroanilino)butanoic acid;hydrochloride |
| SMILES | CCC(C(=O)O)N(N)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C10H13FN2O2.ClH/c1-2-9(10(14)15)13(12)8-5-3-7(11)4-6-8;/h3-6,9H,2,12H2,1H3,(H,14,15);1H |
| InChIKey | VZVALXYJYJELIX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|