C26H26N4O4 — CID 68527527
(E)-1-[3-[(5-amino-2-pyridinyl)oxy]phenyl]-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 68527527) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is (E)-1-[3-[(5-amino-2-pyridinyl)oxy]phenyl]-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-[(5-amino-2-pyridinyl)oxy]phenyl]-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68527527 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (E)-1-[3-[(5-amino-2-pyridinyl)oxy]phenyl]-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Nc1ccc(Oc2cccc(C(=O)/C=C/N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2)nc1 |
| InChI | InChI=1S/C26H26N4O4/c27-21-5-7-26(28-16-21)34-22-3-1-2-20(15-22)23(31)8-9-29-10-12-30(13-11-29)17-19-4-6-24-25(14-19)33-18-32-24/h1-9,14-16H,10-13,17-18,27H2/b9-8+ |
| InChIKey | GMOINFLFZYTPOR-CMDGGOBGSA-N |
| XLogP | 3.70 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|