C15H14N4O4S2 — CID 68528015
2-hydroxy-3-[1-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 68528015) has the molecular formula C15H14N4O4S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-hydroxy-3-[1-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-hydroxy-3-[1-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 68528015 |
| Molecular Formula | C15H14N4O4S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-hydroxy-3-[1-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cn1cc(-c2ccc(S(=O)(=O)n3ccc(C=C(O)C(N)=O)c3)s2)cn1 |
| InChI | InChI=1S/C15H14N4O4S2/c1-18-9-11(7-17-18)13-2-3-14(24-13)25(22,23)19-5-4-10(8-19)6-12(20)15(16)21/h2-9,20H,1H3,(H2,16,21) |
| InChIKey | IKKASAITYUEXCA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|