C7H11NO2S — CID 68534955
2-prop-2-enyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 68534955) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-prop-2-enyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 68534955 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2-prop-2-enyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C=CCC1NC(C(=O)O)CS1 |
| InChI | InChI=1S/C7H11NO2S/c1-2-3-6-8-5(4-11-6)7(9)10/h2,5-6,8H,1,3-4H2,(H,9,10) |
| InChIKey | LDDRAIKEXSMXTA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|