C25H21O5P — CID 68537246
2-[4-(6-hydroxy-3-methyl-2-phenylnaphthalen-1-yl)oxyphenyl]ethenylphosphonic acid (PubChem CID 68537246) has the molecular formula C25H21O5P and a molecular weight of 432.41 g/mol. Its IUPAC name is 2-[4-(6-hydroxy-3-methyl-2-phenylnaphthalen-1-yl)oxyphenyl]ethenylphosphonic acid.
| Compound Name | 2-[4-(6-hydroxy-3-methyl-2-phenylnaphthalen-1-yl)oxyphenyl]ethenylphosphonic acid |
|---|---|
| PubChem CID | 68537246 |
| Molecular Formula | C25H21O5P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[4-(6-hydroxy-3-methyl-2-phenylnaphthalen-1-yl)oxyphenyl]ethenylphosphonic acid |
| SMILES | Cc1cc2cc(O)ccc2c(Oc2ccc(C=CP(=O)(O)O)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21O5P/c1-17-15-20-16-21(26)9-12-23(20)25(24(17)19-5-3-2-4-6-19)30-22-10-7-18(8-11-22)13-14-31(27,28)29/h2-16,26H,1H3,(H2,27,28,29) |
| InChIKey | GPQXRKFBSAAENN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|