C32H31NO3 — CID 58956878
(E)-3-[4-(3-ethyl-6-hydroxy-2-phenylnaphthalen-1-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 58956878) has the molecular formula C32H31NO3 and a molecular weight of 477.60 g/mol. Its IUPAC name is (E)-3-[4-(3-ethyl-6-hydroxy-2-phenylnaphthalen-1-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-[4-(3-ethyl-6-hydroxy-2-phenylnaphthalen-1-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 58956878 |
| Molecular Formula | C32H31NO3 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (E)-3-[4-(3-ethyl-6-hydroxy-2-phenylnaphthalen-1-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | CCc1cc2cc(O)ccc2c(Oc2ccc(/C=C/C(=O)N3CCCCC3)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H31NO3/c1-2-24-21-26-22-27(34)14-17-29(26)32(31(24)25-9-5-3-6-10-25)36-28-15-11-23(12-16-28)13-18-30(35)33-19-7-4-8-20-33/h3,5-6,9-18,21-22,34H,2,4,7-8,19-20H2,1H3/b18-13+ |
| InChIKey | AVKMTRVNNXNHFJ-QGOAFFKASA-N |
| XLogP | 7.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|