C31H30N2O3 — CID 135421346
(E)-3-[4-(2-ethyl-7-hydroxy-3-phenylquinolin-4-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 135421346) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is (E)-3-[4-(2-ethyl-7-hydroxy-3-phenylquinolin-4-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-[4-(2-ethyl-7-hydroxy-3-phenylquinolin-4-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 135421346 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (E)-3-[4-(2-ethyl-7-hydroxy-3-phenylquinolin-4-yl)oxyphenyl]-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | CCc1nc2cc(O)ccc2c(Oc2ccc(/C=C/C(=O)N3CCCCC3)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C31H30N2O3/c1-2-27-30(23-9-5-3-6-10-23)31(26-17-14-24(34)21-28(26)32-27)36-25-15-11-22(12-16-25)13-18-29(35)33-19-7-4-8-20-33/h3,5-6,9-18,21,34H,2,4,7-8,19-20H2,1H3/b18-13+ |
| InChIKey | KAKPYLZIGBNZKF-QGOAFFKASA-N |
| XLogP | 6.99 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|