C30H28O5 — CID 25211774
(E)-3-[4-[3-butyl-6-hydroxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 25211774) has the molecular formula C30H28O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is (E)-3-[4-[3-butyl-6-hydroxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-butyl-6-hydroxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 25211774 |
| Molecular Formula | C30H28O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (E)-3-[4-[3-butyl-6-hydroxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | CCCCc1cc2cc(O)ccc2c(Oc2ccc(/C=C/C(=O)O)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H28O5/c1-3-4-5-22-18-23-19-24(31)11-16-27(23)30(29(22)21-9-14-25(34-2)15-10-21)35-26-12-6-20(7-13-26)8-17-28(32)33/h6-19,31H,3-5H2,1-2H3,(H,32,33)/b17-8+ |
| InChIKey | JDXKMPOOKFBCEW-CAOOACKPSA-N |
| XLogP | 7.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|