C25H20O4S — CID 68541424
(E)-3-[4-(6-methoxy-3-methyl-2-thiophen-3-ylnaphthalen-1-yl)oxyphenyl]prop-2-enoic acid (PubChem CID 68541424) has the molecular formula C25H20O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is (E)-3-[4-(6-methoxy-3-methyl-2-thiophen-3-ylnaphthalen-1-yl)oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(6-methoxy-3-methyl-2-thiophen-3-ylnaphthalen-1-yl)oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68541424 |
| Molecular Formula | C25H20O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (E)-3-[4-(6-methoxy-3-methyl-2-thiophen-3-ylnaphthalen-1-yl)oxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc2c(Oc3ccc(/C=C/C(=O)O)cc3)c(-c3ccsc3)c(C)cc2c1 |
| InChI | InChI=1S/C25H20O4S/c1-16-13-19-14-21(28-2)8-9-22(19)25(24(16)18-11-12-30-15-18)29-20-6-3-17(4-7-20)5-10-23(26)27/h3-15H,1-2H3,(H,26,27)/b10-5+ |
| InChIKey | ARBYEJGCKVOMGG-BJMVGYQFSA-N |
| XLogP | 6.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|