C29H23F3O4 — CID 68536197
3-[4-[6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 68536197) has the molecular formula C29H23F3O4 and a molecular weight of 492.49 g/mol. Its IUPAC name is 3-[4-[6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68536197 |
| Molecular Formula | C29H23F3O4 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 3-[4-[6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc2c(Oc3ccc(C=CC(=O)O)cc3)c(-c3ccccc3)c(CCC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C29H23F3O4/c1-35-24-12-13-25-22(18-24)17-21(15-16-29(30,31)32)27(20-5-3-2-4-6-20)28(25)36-23-10-7-19(8-11-23)9-14-26(33)34/h2-14,17-18H,15-16H2,1H3,(H,33,34) |
| InChIKey | LWUOCMUZZSWRBR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|