C28H21F3O4 — CID 11677309
(E)-3-[4-[6-hydroxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 11677309) has the molecular formula C28H21F3O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is (E)-3-[4-[6-hydroxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[6-hydroxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11677309 |
| Molecular Formula | C28H21F3O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (E)-3-[4-[6-hydroxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Oc2c(-c3ccccc3)c(CCC(F)(F)F)cc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C28H21F3O4/c29-28(30,31)15-14-20-16-21-17-22(32)9-12-24(21)27(26(20)19-4-2-1-3-5-19)35-23-10-6-18(7-11-23)8-13-25(33)34/h1-13,16-17,32H,14-15H2,(H,33,34)/b13-8+ |
| InChIKey | BVPCRBLCJPACOI-MDWZMJQESA-N |
| XLogP | 7.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|