C30H27Cl3N3O7P — CID 68545570
tris[4-chloro-3-(2-methylprop-2-enoylamino)phenyl] phosphate (PubChem CID 68545570) has the molecular formula C30H27Cl3N3O7P and a molecular weight of 678.89 g/mol. Its IUPAC name is tris[4-chloro-3-(2-methylprop-2-enoylamino)phenyl] phosphate.
| Compound Name | tris[4-chloro-3-(2-methylprop-2-enoylamino)phenyl] phosphate |
|---|---|
| PubChem CID | 68545570 |
| Molecular Formula | C30H27Cl3N3O7P |
| Molecular Weight | 678.89 g/mol |
| Exact Mass | 677.07 |
| IUPAC Name | tris[4-chloro-3-(2-methylprop-2-enoylamino)phenyl] phosphate |
| SMILES | C=C(C)C(=O)Nc1cc(OP(=O)(Oc2ccc(Cl)c(NC(=O)C(=C)C)c2)Oc2ccc(Cl)c(NC(=O)C(=C)C)c2)ccc1Cl |
| InChI | InChI=1S/C30H27Cl3N3O7P/c1-16(2)28(37)34-25-13-19(7-10-22(25)31)41-44(40,42-20-8-11-23(32)26(14-20)35-29(38)17(3)4)43-21-9-12-24(33)27(15-21)36-30(39)18(5)6/h7-15H,1,3,5H2,2,4,6H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | KMMYSRGHXAGXFC-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.89 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|