C25H36N2O3 — CID 68547444
tert-butyl 2-[1-[4-(3-aminophenyl)phenyl]ethylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 68547444) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-(3-aminophenyl)phenyl]ethylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl 2-[1-[4-(3-aminophenyl)phenyl]ethylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 68547444 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | tert-butyl 2-[1-[4-(3-aminophenyl)phenyl]ethylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(NC(COC(C)(C)C)C(=O)OC(C)(C)C)c1ccc(-c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C25H36N2O3/c1-17(18-11-13-19(14-12-18)20-9-8-10-21(26)15-20)27-22(16-29-24(2,3)4)23(28)30-25(5,6)7/h8-15,17,22,27H,16,26H2,1-7H3 |
| InChIKey | OFEPBTNIYJBZQR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|