C9H10N2O3 — CID 68551177
(7-methoxypyrazolo[1,5-a]pyridin-4-yl)methanediol (PubChem CID 68551177) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is (7-methoxypyrazolo[1,5-a]pyridin-4-yl)methanediol.
| Compound Name | (7-methoxypyrazolo[1,5-a]pyridin-4-yl)methanediol |
|---|---|
| PubChem CID | 68551177 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (7-methoxypyrazolo[1,5-a]pyridin-4-yl)methanediol |
| SMILES | COc1ccc(C(O)O)c2ccnn12 |
| InChI | InChI=1S/C9H10N2O3/c1-14-8-3-2-6(9(12)13)7-4-5-10-11(7)8/h2-5,9,12-13H,1H3 |
| InChIKey | CZAMZINZYYKJKL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|